2-(2-hydroxyphenyl)-1h-benzimidazole structure
|
Common Name | 2-(2-hydroxyphenyl)-1h-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 2963-66-8 | Molecular Weight | 210.23100 | |
| Density | 1.289g/cm3 | Boiling Point | 388.6ºC at 760mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | 239-243ºC | |
| MSDS | N/A | Flash Point | 167.6ºC | |
Use of 2-(2-hydroxyphenyl)-1h-benzimidazole2-(2′-Hydroxyphenyl)benzimidazole is some of the most extensively studied excited state intramolecular proton transfer (ESIPT) molecules exhibiting normal and tautomer emissions. 2-(2′-Hydroxyphenyl)benzimidazole has been applied as a fluorescent probe in various systems[1]. |
| Name | 2-(2-hydroxyphenyl)-1h-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Description | 2-(2′-Hydroxyphenyl)benzimidazole is some of the most extensively studied excited state intramolecular proton transfer (ESIPT) molecules exhibiting normal and tautomer emissions. 2-(2′-Hydroxyphenyl)benzimidazole has been applied as a fluorescent probe in various systems[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760mmHg |
| Melting Point | 239-243ºC |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 167.6ºC |
| Exact Mass | 210.07900 |
| PSA | 48.91000 |
| LogP | 2.93550 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | XWXMGTIHBYFTIE-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c1nc2ccccc2[nH]1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37/39 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| o-(1H-Benzimidazol-2-yl)phenol |
| 2-(1H-Benzo[d]imidazol-2-yl)phenol |
| 2(1H)-PYRIMIDINETHIONE,4-AMINO-6-METHYL-(9CI) |
| 2-(2-HYDROXYMETHYL)-1H-BENZIMIDAZOLE |
| 2-(1H-Benzimidazole-2-yl)phenol,2-(1H-Benzimidazole-Z-yl)phenol,2-(1H-Benzoimidazol-2-yl)-phenol |