Methyl 2-(6-methoxynaphthalen-2-yl)propanoate structure
|
Common Name | Methyl 2-(6-methoxynaphthalen-2-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 30012-51-2 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Naproxen methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 35.53000 |
| LogP | 3.12490 |
| InChIKey | ZFYFBPCRUQZGJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)c1ccc2cc(OC)ccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD09954559 |