(Iodomethyl)(triphenyl)phosphonium iodide structure
|
Common Name | (Iodomethyl)(triphenyl)phosphonium iodide | ||
|---|---|---|---|---|
| CAS Number | 3020-28-8 | Molecular Weight | 530.121 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17I2P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | iodomethyl(triphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H17I2P |
|---|---|
| Molecular Weight | 530.121 |
| Exact Mass | 529.915710 |
| PSA | 13.59000 |
| LogP | 5.25870 |
| InChIKey | NAVMMSRRNOXQMJ-UHFFFAOYSA-M |
| SMILES | IC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-28 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonium, (iodomethyl)triphenyl-, iodide (1:1) |
| I(-)PPh3-CH2I(+) |
| PPh3PCH2I(+)I(-) |
| [Ph3PCH2I](+)*I(-) |
| (Ph3P(1+)CH2I)I(1-) |
| (Iodomethyl)(triphenyl)phosphonium iodide |
| (Ph3PCH2I)(1+)I(1-) |
| (Iodomethyl)triphenylphosphonium iodide |