5-(2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL)-& structure
|
Common Name | 5-(2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL)-& | ||
|---|---|---|---|---|
| CAS Number | 302911-88-2 | Molecular Weight | 290.62200 | |
| Density | 1.486g/cm3 | Boiling Point | 375.4ºC at 760 mmHg | |
| Molecular Formula | C12H6ClF3O3 | Melting Point | 215-219ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 180.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760 mmHg |
| Melting Point | 215-219ºC (dec.)(lit.) |
| Molecular Formula | C12H6ClF3O3 |
| Molecular Weight | 290.62200 |
| Flash Point | 180.8ºC |
| Exact Mass | 289.99600 |
| PSA | 50.44000 |
| LogP | 4.31700 |
| Index of Refraction | 1.525 |
| InChIKey | SSIFVNBQAZVYCS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
|
~87%
5-(2-CHLORO-5-(... CAS#:302911-88-2 |
| Literature: Gorak; Obushak; Matiichuk; Lytvyn Russian Journal of Organic Chemistry, 2009 , vol. 45, # 4 p. 541 - 550 |
|
~%
5-(2-CHLORO-5-(... CAS#:302911-88-2 |
| Literature: Phosphorus, Sulfur and Silicon and the Related Elements, , vol. 182, # 5 p. 1083 - 1091 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00274247 |
| 5-(2-chloro-5-trifluoromethylphenyl)furan-2-carboxylic acid |
| 5-[2-Chloro-5-(trifluoromethyl)phenyl]-2-furancarboxylic acid |
| 5-(2-chloro-5-trifluoromethylphenyl)-2-furoic acid |