5-sulfosalicylic acid hydrate 95 structure
|
Common Name | 5-sulfosalicylic acid hydrate 95 | ||
|---|---|---|---|---|
| CAS Number | 304851-84-1 | Molecular Weight | 236.19900 | |
| Density | N/A | Boiling Point | 623.3ºC at 760 mmHg | |
| Molecular Formula | C7H8O7S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 330.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-hydroxy-5-sulfobenzoic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 623.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H8O7S |
| Molecular Weight | 236.19900 |
| Flash Point | 330.8ºC |
| Exact Mass | 235.99900 |
| PSA | 129.51000 |
| LogP | 1.35360 |
| InChIKey | PAUDQWJTTVPGHZ-UHFFFAOYSA-N |
| SMILES | O.O=C(O)c1cc(S(=O)(=O)O)ccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918290000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Anti-oxidative and anti-inflammatory effects of lipoic acid in rat liver.
Microbiology 69 , 270-6, (2015) Lipopolysaccharide (LPS) is a key inflammatory component of Gram-negative bacteria, which after entering the systemic circulation contributes to the development of septic hepatic failure.The aim of th... |
|
|
Nuclear factor κB inhibitor BAY 11-7082 suppresses oxidative stress induced by endothelin-1 (ET-1) in rat kidney.
Postepy. Hig. Med. Dosw. 69 , 1512-8, (2016) The aim of the study was to evaluate the effect of BAY 11-7082, an NF-κB inhibitor, on basal and ET-1-induced production of reactive oxygen species (ROS), TNF-α and p65 protein in rat kidney.The exper... |
| MFCD00192459 |
| EINECS 202-555-6 |
| HMS2289M10 |
| 5-Sulfosalicylic acid hydrate |
| 5-sulfosalicylic acid monohydrate |
| 2-hydroxy-5-sulfobenzoic acid hydrate |