CP-628006
Modify Date: 2025-08-25 12:09:44
CP-628006 structure
|
Common Name | CP-628006 | ||
|---|---|---|---|---|
| CAS Number | 305822-08-6 | Molecular Weight | 536.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H35F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CP-628006CP-628006, a small molecule CFTR potentiator, restores ATP-dependent channel gating to the cystic fibrosis mutant G551D-CFTR. |
| Name | CP-628006 |
|---|
| Description | CP-628006, a small molecule CFTR potentiator, restores ATP-dependent channel gating to the cystic fibrosis mutant G551D-CFTR. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H35F3N2O2 |
|---|---|
| Molecular Weight | 536.63 |
| InChIKey | KCAXPRFNWUOBNC-RDAHNBDFSA-N |
| SMILES | Cc1ncccc1CNC(=O)c1ccc2c(c1)CCC1CC(O)(CCC(F)(F)F)CCC21Cc1ccccc1 |