Phenol,4,4'-sulfonylbis[2,6-dichloro-
Modify Date: 2025-08-25 13:32:32
Phenol,4,4'-sulfonylbis[2,6-dichloro- structure
|
Common Name | Phenol,4,4'-sulfonylbis[2,6-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 30609-79-1 | Molecular Weight | 388.05100 | |
| Density | 1.744g/cm3 | Boiling Point | 538.7ºC at 760mmHg | |
| Molecular Formula | C12H6Cl4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.6ºC | |
| Name | 2,6-dichloro-4-(3,5-dichloro-4-hydroxyphenyl)sulfonylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.744g/cm3 |
|---|---|
| Boiling Point | 538.7ºC at 760mmHg |
| Molecular Formula | C12H6Cl4O4S |
| Molecular Weight | 388.05100 |
| Flash Point | 279.6ºC |
| Exact Mass | 385.87400 |
| PSA | 82.98000 |
| LogP | 5.62500 |
| Index of Refraction | 1.665 |
| InChIKey | YYDJTJGFHTVGGF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1cc(Cl)c(O)c(Cl)c1)c1cc(Cl)c(O)c(Cl)c1 |
|
~%
Phenol,4,4'-sul... CAS#:30609-79-1 |
| Literature: Lue, Jian; Han, Li-Wei; Lin, Jing-Xiang; Cao, Rong Crystal Growth and Design, 2011 , vol. 11, # 6 p. 2035 - 2038 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bis-<3.5-dichlor-4-hydroxy-phenyl>-sulfon,2.6.2'.6'-Tetrachlor-4.4'-sulfonyl-di-phenol |