4,4'-Sulfonylbis(2,6-dimethylphenol) structure
|
Common Name | 4,4'-Sulfonylbis(2,6-dimethylphenol) | ||
|---|---|---|---|---|
| CAS Number | 13288-70-5 | Molecular Weight | 306.377 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 535.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O4S | Melting Point | 297ºC | |
| MSDS | N/A | Flash Point | 277.3±30.1 °C | |
| Name | Bis(3,5-dimethyl-4-hydroxyphenyl) Sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 535.0±50.0 °C at 760 mmHg |
| Melting Point | 297ºC |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.377 |
| Flash Point | 277.3±30.1 °C |
| Exact Mass | 306.092590 |
| PSA | 82.98000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | SUCTVKDVODFXFX-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
|
~%
4,4'-Sulfonylbi... CAS#:13288-70-5 |
| Literature: Monatshefte fuer Chemie, , vol. 91, p. 57 - 78 |
|
~%
4,4'-Sulfonylbi... CAS#:13288-70-5 |
| Literature: Monatshefte fuer Chemie, , vol. 91, p. 57 - 78 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,4'-Sulfonylbis(2,6-dimethylphenol) |
| Phenol, 4,4'-sulfonylbis[2,6-dimethyl- |
| 4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol |
| Bis(4-hydroxy-3,5-diMethylphenyl) Sulfone |