Perfluorododecane structure
|
Common Name | Perfluorododecane | ||
|---|---|---|---|---|
| CAS Number | 307-59-5 | Molecular Weight | 638.087 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 192.1±8.0 °C at 760 mmHg | |
| Molecular Formula | C12F26 | Melting Point | 75 °C | |
| MSDS | N/A | Flash Point | 77.1±10.2 °C | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluorododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 192.1±8.0 °C at 760 mmHg |
| Melting Point | 75 °C |
| Molecular Formula | C12F26 |
| Molecular Weight | 638.087 |
| Flash Point | 77.1±10.2 °C |
| Exact Mass | 637.958496 |
| LogP | 10.99 |
| Vapour Pressure | 0.7±0.4 mmHg at 25°C |
| Index of Refraction | 1.265 |
| InChIKey | WNZGTRLARPEMIG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903399090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Hexacosafluor-dodecan |
| n-Perfluorododecane |
| MFCD00042084 |
| EINECS 206-204-8 |
| perfluoro-n-dodecane |
| PC5992D |
| Hexacosafluorododecane |
| Perfluorododecane |
| Perfluoro-dodecane |
| hexacosafluoro-dodecane |