n-butyl perfluorooctanoate structure
|
Common Name | n-butyl perfluorooctanoate | ||
|---|---|---|---|---|
| CAS Number | 307-96-0 | Molecular Weight | 470.17500 | |
| Density | 1.506g/cm3 | Boiling Point | 215.8ºC at 760 mmHg | |
| Molecular Formula | C12H9F15O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.1ºC | |
| Name | n-butyl perfluorooctanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 215.8ºC at 760 mmHg |
| Molecular Formula | C12H9F15O2 |
| Molecular Weight | 470.17500 |
| Flash Point | 82.1ºC |
| Exact Mass | 470.03600 |
| PSA | 26.30000 |
| LogP | 5.70380 |
| Index of Refraction | 1.318 |
| InChIKey | SBMFZWPPSPRLTN-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2915900090 |
|
~%
n-butyl perfluo... CAS#:307-96-0 |
| Literature: Faurote et al. Industrial and Engineering Chemistry, 1956 , vol. 48, p. 445,447 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Pentadecafluor-octansaeure-butylester |
| Perfluorooctanoicacidbutylester |
| BUTYL PERFLUOROOCTANOATE |
| pentadecafluoro-octanoic acid butyl ester |