1h,1h-pentadecafluoro-1-octanol
1h,1h-pentadecafluoro-1-octanol structure
|
Common Name | 1h,1h-pentadecafluoro-1-octanol | ||
|---|---|---|---|---|
| CAS Number | 307-30-2 | Molecular Weight | 400.085 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 164.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F15O | Melting Point | 44-47 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 49.2±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 164.0±0.0 °C at 760 mmHg |
| Melting Point | 44-47 °C(lit.) |
| Molecular Formula | C8H3F15O |
| Molecular Weight | 400.085 |
| Flash Point | 49.2±27.3 °C |
| Exact Mass | 399.994446 |
| PSA | 20.23000 |
| LogP | 5.51 |
| Vapour Pressure | 0.7±0.6 mmHg at 25°C |
| Index of Refraction | 1.285 |
| InChIKey | PJDOLCGOTSNFJM-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2905590090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 6 | |
CAS#:335-67-1
CAS#:335-64-8
CAS#:3108-24-5
CAS#:376-27-2
CAS#:307-96-0
CAS#:307-98-2
CAS#:3934-23-4
CAS#:24962-65-0
CAS#:812-72-6
CAS#:17352-09-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-dihydroperfluorooctanol |
| 2,2,3,3,4,4,4-HEPTAFLUOROBUTYL METHACRYLATE |
| perfluorooctanol |
| 1,1-dihydroperfluorooctyl alcohol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-1-octanol |
| 1-Octanol,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctyl alcohol |
| 1H,1H-Pentadecafluoro-1-octanol |
| 1h,1h-perfluorooctanol |
| 1H,1H-pentadecafluorooctan-1-ol |
| 1H,1H-Perfluoro-1-octanol |
| MFCD00004675 |
| 1h,1h-perfluorooctan-1-ol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-l-ol |
| EINECS 206-197-1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is PJDOLCGOTSNFJM-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: Related downstream products(CAS) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol: 307-98-2;3934-23-4;335-67-1;24962-65-0;812-72-6;17352-09-9. |
| Q: What is the English name of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: The English name of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol. |
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is 307-30-2. |
| Q: What is the molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: Molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is C8H3F15O. |
| Q: What are the upstream materials of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: Related upstream materials(CAS) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol: 335-67-1;335-64-8;3108-24-5;376-27-2;307-96-0. |
| Q: What is the molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: Molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is 400.085. |
| Q: What is the LogP of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: LogP of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is 5.51. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol? |
| A: Melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol is 44-47 °C(lit.). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |