1h,1h-pentadecafluoro-1-octanol structure
|
Common Name | 1h,1h-pentadecafluoro-1-octanol | ||
|---|---|---|---|---|
| CAS Number | 307-30-2 | Molecular Weight | 400.085 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 164.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F15O | Melting Point | 44-47 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 49.2±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 164.0±0.0 °C at 760 mmHg |
| Melting Point | 44-47 °C(lit.) |
| Molecular Formula | C8H3F15O |
| Molecular Weight | 400.085 |
| Flash Point | 49.2±27.3 °C |
| Exact Mass | 399.994446 |
| PSA | 20.23000 |
| LogP | 5.51 |
| Vapour Pressure | 0.7±0.6 mmHg at 25°C |
| Index of Refraction | 1.285 |
| InChIKey | PJDOLCGOTSNFJM-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2905590090 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1-dihydroperfluorooctanol |
| 2,2,3,3,4,4,4-HEPTAFLUOROBUTYL METHACRYLATE |
| perfluorooctanol |
| 1,1-dihydroperfluorooctyl alcohol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-1-octanol |
| 1-Octanol,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctyl alcohol |
| 1H,1H-Pentadecafluoro-1-octanol |
| 1h,1h-perfluorooctanol |
| 1H,1H-pentadecafluorooctan-1-ol |
| 1H,1H-Perfluoro-1-octanol |
| MFCD00004675 |
| 1h,1h-perfluorooctan-1-ol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-l-ol |
| EINECS 206-197-1 |