Acetamide,N,N'-(oxydi-4,1-phenylene)bis- (9CI) structure
|
Common Name | Acetamide,N,N'-(oxydi-4,1-phenylene)bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3070-86-8 | Molecular Weight | 284.31000 | |
| Density | 1.256g/cm3 | Boiling Point | 554.4ºC at 760mmHg | |
| Molecular Formula | C16H16N2O3 | Melting Point | 230-231ºC(lit.) | |
| MSDS | N/A | Flash Point | 289.1ºC | |
| Name | N-[4-(4-acetamidophenoxy)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 554.4ºC at 760mmHg |
| Melting Point | 230-231ºC(lit.) |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31000 |
| Flash Point | 289.1ºC |
| Exact Mass | 284.11600 |
| PSA | 67.43000 |
| LogP | 3.54170 |
| Index of Refraction | 1.637 |
| InChIKey | BUGCHAIWUSBYIZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(NC(C)=O)cc2)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n,n'-(oxydibenzene-4,1-diyl)diacetamide |
| N,N'-(Oxydi-4,1-phenylene)bisacetamide |
| bis(4-acetylaminophenyl) ether |
| N-[4-(4-acetylaminophenoxy)phenyl]acetamide |
| 4,4'-Oxybisacetanilide |
| 4,4'-diacetamido-diphenyl ether |
| Bis(p-acetylaminophenyl) ether |
| MFCD00050458 |
| N,N'-Diacetyl-4,4'-diaminodiphenyl ether |