4-(4-Nitrophenoxy)aniline structure
|
Common Name | 4-(4-Nitrophenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 6149-33-3 | Molecular Weight | 230.219 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H10N2O3 | Melting Point | 132 °C | |
| MSDS | Chinese USA | Flash Point | 188.1±22.3 °C | |
| Name | 4-(4-Nitrophenoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.4±22.0 °C at 760 mmHg |
| Melting Point | 132 °C |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.219 |
| Flash Point | 188.1±22.3 °C |
| Exact Mass | 230.069138 |
| PSA | 81.07000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ASAOLTVUTGZJST-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2922299090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| EINECS 228-159-3 |
| 4-(4-Nitrophenoxy)aniline |
| 4-Amino-4'-nitrodiphenyl ether |
| MFCD00060609 |
| 4-nitrophenoxyaniline |