3-Amino-3-(4-isopropoxy-phenyl)-propionic acid structure
|
Common Name | 3-Amino-3-(4-isopropoxy-phenyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 311321-19-4 | Molecular Weight | 223.26800 | |
| Density | 1.143g/cm3 | Boiling Point | 372.8ºC at 760mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3ºC | |
| Name | 3-Amino-3-(4-isopropoxy-phenyl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 179.3ºC |
| Exact Mass | 223.12100 |
| PSA | 72.55000 |
| LogP | 2.64860 |
| Index of Refraction | 1.542 |
| InChIKey | GQJOHIGVBBGCRS-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(C(N)CC(=O)O)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922509090 |
|
~61%
3-Amino-3-(4-is... CAS#:311321-19-4 |
| Literature: Russian Journal of General Chemistry, , vol. 75, # 7 p. 1113 - 1124 |
|
~%
3-Amino-3-(4-is... CAS#:311321-19-4 |
| Literature: Russian Journal of General Chemistry, , vol. 75, # 7 p. 1113 - 1124 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-amino-3-(4-propan-2-yloxyphenyl)propanoic acid |