(3-Amino-2,4,6-triiodophenyl)acetic acid structure
|
Common Name | (3-Amino-2,4,6-triiodophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 3119-17-3 | Molecular Weight | 528.85200 | |
| Density | 2.852g/cm3 | Boiling Point | 518.1ºC at 760 mmHg | |
| Molecular Formula | C8H6I3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.2ºC | |
| Name | 2-(3-amino-2,4,6-triiodophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.852g/cm3 |
|---|---|
| Boiling Point | 518.1ºC at 760 mmHg |
| Molecular Formula | C8H6I3NO2 |
| Molecular Weight | 528.85200 |
| Flash Point | 267.2ºC |
| Exact Mass | 528.75300 |
| PSA | 63.32000 |
| LogP | 3.29090 |
| Index of Refraction | 1.814 |
| InChIKey | INVBOJSWUDDQJX-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc(I)c(CC(=O)O)c1I |
| HS Code | 2922499990 |
|---|
|
~62%
(3-Amino-2,4,6-... CAS#:3119-17-3 |
| Literature: Weichert; Longino; Schwendner; Counsell Journal of Medicinal Chemistry, 1986 , vol. 29, # 9 p. 1674 - 1682 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-Amino-2,4,6-triiod-phenylessigsaeure |
| Acido 3-amino-2,4,6-triiodofenilacetico |