Ellagic acid (hydrate) structure
|
Common Name | Ellagic acid (hydrate) | ||
|---|---|---|---|---|
| CAS Number | 314041-08-2 | Molecular Weight | 338.22300 | |
| Density | N/A | Boiling Point | 871.2ºC at 760 mmHg | |
| Molecular Formula | C14H8O9 | Melting Point | >300ºC | |
| MSDS | USA | Flash Point | 480.7ºC | |
Use of Ellagic acid (hydrate)Ellagic acid hydrate is a natural antioxidant, and acts as a potent and ATP-competitive CK2 inhibitor, with an IC50 of 40 nM and a Ki of 20 nM[1]. |
| Name | ellagic acid hydrate tech. |
|---|---|
| Synonym | More Synonyms |
| Description | Ellagic acid hydrate is a natural antioxidant, and acts as a potent and ATP-competitive CK2 inhibitor, with an IC50 of 40 nM and a Ki of 20 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
CK2:20 nM (Ki) CK2:40 nM (IC50) |
| References |
| Boiling Point | 871.2ºC at 760 mmHg |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C14H8O9 |
| Molecular Weight | 338.22300 |
| Flash Point | 480.7ºC |
| Exact Mass | 338.02700 |
| PSA | 159.80000 |
| LogP | 1.18420 |
| InChIKey | UOZZJRXBNGVIKO-UHFFFAOYSA-N |
| SMILES | O.O=c1oc2c(O)c(O)cc3c(=O)oc4c(O)c(O)cc1c4c23 |
| Storage condition | -20℃ |
| Ellagic acid hydrate 10GR |
| MFCD00149494 |
| EINECS 207-508-3 |
| Ellagic acid hydrate |