4-Nitro-3-(trifluoromethyl)benzonitrile structure
|
Common Name | 4-Nitro-3-(trifluoromethyl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 320-36-5 | Molecular Weight | 216.11700 | |
| Density | 1.49g/cm3 | Boiling Point | 304.2ºC at 760 mmHg | |
| Molecular Formula | C8H3F3N2O2 | Melting Point | 84-86ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 113ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitro-3-(trifluoromethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 304.2ºC at 760 mmHg |
| Melting Point | 84-86ºC(lit.) |
| Molecular Formula | C8H3F3N2O2 |
| Molecular Weight | 216.11700 |
| Flash Point | 113ºC |
| Exact Mass | 216.01500 |
| PSA | 69.61000 |
| LogP | 3.00848 |
| Index of Refraction | 1.498 |
| InChIKey | AVSDRULQBQMLES-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD05664270 |
| 4-NITRO-3-TRIFLUOROMETHYLBENZONITRILE |
| 4-Nitro-3-trifluormethyl-benzonitril |