hexoprenaline sulphate structure
|
Common Name | hexoprenaline sulphate | ||
|---|---|---|---|---|
| CAS Number | 3215-70-1 | Molecular Weight | 420.49900 | |
| Density | 1.302g/cm3 | Boiling Point | 707.8ºC at 760mmHg | |
| Molecular Formula | C22H32N2O6 | Melting Point | 162-165° (hemihydrate) | |
| MSDS | N/A | Flash Point | 186ºC | |
Use of hexoprenaline sulphateHexoprenaline is an orally active and selective β-adrenergic receptor agonist that dilates the bronchi. Hexoprenaline can be used in the study of bronchospasm, including asthma, bronchitis, and emphysema[1]. |
| Name | 4-[2-[6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Hexoprenaline is an orally active and selective β-adrenergic receptor agonist that dilates the bronchi. Hexoprenaline can be used in the study of bronchospasm, including asthma, bronchitis, and emphysema[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 707.8ºC at 760mmHg |
| Melting Point | 162-165° (hemihydrate) |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.49900 |
| Flash Point | 186ºC |
| Exact Mass | 420.22600 |
| PSA | 145.44000 |
| LogP | 2.79740 |
| InChIKey | OXLZNBCNGJWPRV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C(O)CNCCCCCCNCC(O)c2ccc(O)c(O)c2)cc1O |
| Hexoprenalino [INN-Spanish] |
| Gynipral |
| 4,4'-[1,6-hexanediylbis[imino(1-hydroxy-2,1-ethanediyl)]]bis-1,2-benzenediol |
| Hexoprenaline [INN:BAN] |
| Etoscol |
| Esoprenalina [DCIT] |
| Hexoprenalinum [INN-Latin] |
| 1,2-Benzenediol,4,4'-(1,6-hexanediylbis(imino(1-hydroxy-2,1-ethanediyl)))bis |
| Ginipral |
| N,N'-bis[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]hexamethylenediamine |
| (+/-)-Hexoprenaline |