LHRH (1-2) (free acid) acetate salt structure
|
Common Name | LHRH (1-2) (free acid) acetate salt | ||
|---|---|---|---|---|
| CAS Number | 32159-22-1 | Molecular Weight | 266.25300 | |
| Density | 1.65g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LHRH (1-2) (free acid) acetate saltPyroglutamylhistidine is a dipeptide. |
| Name | pGlu-His-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.25300 |
| Exact Mass | 266.10200 |
| PSA | 124.18000 |
| Index of Refraction | 1.724 |
| InChIKey | XFWCSGJOVUQCME-YUMQZZPRSA-N |
| SMILES | O=C1CCC(C(=O)NC(Cc2cnc[nH]2)C(=O)O)N1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-L-Pyroglutaminyl-histidin |
| L-pyroglutamyl-L-histidine |
| LHRH (1-2) (free acid) |