H-Ser-Met-OH structure
|
Common Name | H-Ser-Met-OH | ||
|---|---|---|---|---|
| CAS Number | 3227-09-6 | Molecular Weight | 236.28900 | |
| Density | 1.334g/cm3 | Boiling Point | 597.1ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.9ºC | |
| Name | Ser-Met |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 597.1ºC at 760 mmHg |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.28900 |
| Flash Point | 314.9ºC |
| Exact Mass | 236.08300 |
| PSA | 137.95000 |
| Index of Refraction | 1.56 |
| InChIKey | PBUXMVYWOSKHMF-WDSKDSINSA-N |
| SMILES | CSCCC(NC(=O)C(N)CO)C(=O)O |
|
~%
H-Ser-Met-OH CAS#:3227-09-6 |
| Literature: Hofmann et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1636,1639 |
|
~%
H-Ser-Met-OH CAS#:3227-09-6 |
| Literature: Hofmann et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1636,1639 |
|
~%
H-Ser-Met-OH CAS#:3227-09-6 |
| Literature: Hofmann et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1636,1639 |
| L-Seryl=>L-methionin |
| Serylmethionine |
| N-L-Seryl-L-methionin |
| N-L-seryl-L-methionine |
| L-Ser-L-Met |
| L-Seryl-L-methionine |
| L-Methionine,N-L-seryl |
| Ser-met |
| (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoic acid |
| Serinyl-Methionine |