ALPHA-(4-TOLYLIMINO)-P-CRESOL structure
|
Common Name | ALPHA-(4-TOLYLIMINO)-P-CRESOL | ||
|---|---|---|---|---|
| CAS Number | 3230-51-1 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | 218-222ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[(4-methylanilino)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 218-222ºC(lit.) |
|---|---|
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 29.10000 |
| LogP | 3.05890 |
| InChIKey | LXUWDLKAQOFUGU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Cc2ccc(O)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925290090 |
|
~99%
ALPHA-(4-TOLYLI... CAS#:3230-51-1 |
| Literature: Rothenberg; Downie; Raston; Scott Journal of the American Chemical Society, 2001 , vol. 123, # 36 p. 8701 - 8708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ALPHA-(4-TOLYLIMINO)-P-CRESOL |
| 4-Hydroxy-benzaldehyd-p-tolylimin |
| N-(4-Hydroxybenzylidene)-p-toluidine |
| MFCD00029735 |
| p-hydroxybenzal-p-toluidine |