3-Hydroxy-5-(trifluoromethyl)benzoic acid structure
|
Common Name | 3-Hydroxy-5-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 328-69-8 | Molecular Weight | 206.119 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 333.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F3O3 | Melting Point | 191-193ºC | |
| MSDS | N/A | Flash Point | 155.6±27.9 °C | |
| Name | 3-hydroxy-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.7±42.0 °C at 760 mmHg |
| Melting Point | 191-193ºC |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.119 |
| Flash Point | 155.6±27.9 °C |
| Exact Mass | 206.019073 |
| PSA | 57.53000 |
| LogP | 3.45 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | BJUOAPFXYPEEMK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918290000 |
|
~64%
3-Hydroxy-5-(tr... CAS#:328-69-8 |
| Literature: LG LIFE SCIENCES, LTD. Patent: WO2007/58504 A1, 2007 ; Location in patent: Page/Page column 78 ; |
|
~%
3-Hydroxy-5-(tr... CAS#:328-69-8 |
| Literature: WO2007/64045 A1, ; Page/Page column 341-342 ; WO 2007/064045 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 3-hydroxy-5-(trifluoromethyl)- |
| 3-Hydroxy-5-trifluoromethylbenzoic acid |
| 3-Hydroxy-5-(trifluoromethyl)benzoic acid |
| 3-Hydroxy-5-trifluormethyl-benzoesaeure |