1-Chloro-3,5-bis(trifluoromethyl)benzene structure
|
Common Name | 1-Chloro-3,5-bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 328-72-3 | Molecular Weight | 248.553 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 125.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H3ClF6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42.7±19.4 °C | |
| Name | 1-chloro-3,5-bis(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 125.0±35.0 °C at 760 mmHg |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.553 |
| Flash Point | 42.7±19.4 °C |
| Exact Mass | 247.982742 |
| LogP | 4.63 |
| Vapour Pressure | 15.0±0.2 mmHg at 25°C |
| Index of Refraction | 1.403 |
| InChIKey | OXMBWPJFVUPOFO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | 1993.0 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Chloro-3,5-bis(trifluoromethyl)benzene |
| MFCD01861848 |
| 1-Chlor-3,5-bis-trifluormethyl-benzol |
| 3,5-Bis(trifluoromethyl)chlorobenzene |
| 1-chloro-3,5-bis-trifluoromethyl-benzene |
| FXFFR CG EXFFF |