3,5-Bis(trifluoromethyl)benzonitrile structure
|
Common Name | 3,5-Bis(trifluoromethyl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 27126-93-8 | Molecular Weight | 239.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 175.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H3F6N | Melting Point | 16°C | |
| MSDS | N/A | Flash Point | 72.8±0.0 °C | |
| Name | 3,5-Bis(trifluoromethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 175.8±35.0 °C at 760 mmHg |
| Melting Point | 16°C |
| Molecular Formula | C9H3F6N |
| Molecular Weight | 239.117 |
| Flash Point | 72.8±0.0 °C |
| Exact Mass | 239.016968 |
| PSA | 23.79000 |
| LogP | 3.74 |
| Vapour Pressure | 1.1±0.3 mmHg at 25°C |
| Index of Refraction | 1.417 |
| InChIKey | CZKHHAOIHXHOSR-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S23-S26-S28-S37/39-S36/37/39-S36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
|
~83%
3,5-Bis(trifluo... CAS#:27126-93-8 |
| Literature: MITSUBISHI GAS CHEMICAL COMPANY, INC. Patent: EP1500641 A1, 2005 ; Location in patent: Page 11 ; |
|
~64%
3,5-Bis(trifluo... CAS#:27126-93-8 |
| Literature: Eckert, Markus Patent: US2003/18209 A1, 2003 ; |
|
~86%
3,5-Bis(trifluo... CAS#:27126-93-8 |
| Literature: Schareina, Thomas; Zapf, Alexander; Cotte, Alain; Gotta, Matthias; Beller, Matthias Advanced Synthesis and Catalysis, 2011 , vol. 353, # 5 p. 777 - 780 |
|
~64%
3,5-Bis(trifluo... CAS#:27126-93-8 |
| Literature: Muller, Nikolaus; Magerlein, Wolfgang; Beller, Matthias; Schareina, Thomas; Zapf, Alexander Patent: US2009/62541 A1, 2009 ; Location in patent: Page/Page column 4 ; |
|
~%
3,5-Bis(trifluo... CAS#:27126-93-8 |
| Literature: Brooner, Rachel E. M.; Brown, Timothy J.; Widenhoefer, Ross A. Angewandte Chemie - International Edition, 2013 , vol. 52, # 24 p. 6259 - 6261 Angew. Chem., 2013 , vol. 125, # 24 p. 6379 - 6381,3 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| FXFFR CCN EXFFF |
| 3,5-(bistrifluoromethyl)benzonitrile |
| Benzonitrile, 3,5-bis(trifluoromethyl)- |
| 3,5-Bis(trifluoromethyl)benzonitrile |
| MBT-CN |
| 3,5-(CF3)2C6H3CN |
| MFCD00000379 |
| Bis(3,5-trifluoromethyl)benzonitrile |
| ditrifluoromethylbenzonitrile |
| 3,5-bis(trifluoromethyl)benzenecarbonitrile |
| 3,5-di(Trifluoromethyl)benzonitrile |
| EINECS 248-240-7 |