4-(Trifluoromethoxy)benzoic acid structure
|
Common Name | 4-(Trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 330-12-1 | Molecular Weight | 206.119 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 230.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F3O3 | Melting Point | 150-154 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 93.0±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.2±35.0 °C at 760 mmHg |
| Melting Point | 150-154 °C(lit.) |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.119 |
| Flash Point | 93.0±25.9 °C |
| Exact Mass | 206.019073 |
| PSA | 46.53000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | RATSANVPHHXDCT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
NMR spectroscopic and theoretical chemistry studies on the internal acyl migration reactions of the 1-O-acyl-beta-D-glucopyranuronate conjugates of 2-, 3-, and 4-(trifluoromethyl) benzoic acids.
Chem. Res. Toxicol. 9(8) , 1414-24, (1996) High resolution 19F NMR spectroscopy has been used to investigate the kinetics of internal acyl migration and hydrolysis of the synthetic beta -1-O-acyl-D-glucopyranuronates of 2-, 3-, and 4-(trifluor... |
| QVR DOXFFF |
| trans-4-trifluoromethoxybenzoic acid |
| p-Trifluoromethoxybenzoic acid |
| α,α,α-Trifluoro-p-anisic Acid |
| 4-(Trifluoromethoxy)benzoic acid |
| Benzoic acid, 4-(trifluoromethoxy)- |
| p-Carboxyphenyl trifluoromethyl ether |
| 4-Trifluormethoxy-benzoesaeure |
| 4-Trifluoromethoxy-benzoic acid |
| p-(Trifluoromethoxy)benzoic acid |
| 4-trifluoromethyloxybenzoic acid |
| EINECS 206-352-3 |
| MFCD00002541 |