4′-(Trifluoromethoxy)acetophenone structure
|
Common Name | 4′-(Trifluoromethoxy)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 85013-98-5 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 215.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 87.8±0.0 °C | |
| Name | 4'-(Trifluoromethoxy)acetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 215.4±35.0 °C at 760 mmHg |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 87.8±0.0 °C |
| Exact Mass | 204.039810 |
| PSA | 26.30000 |
| LogP | 2.78 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | MOEXTBIPPMLEFX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OC(F)(F)F)cc1 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39-S23 |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: WO2011/137024 A1, ; Page/Page column 54-55 ; |
|
~%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: US4925863 A1, ; |
|
~92%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: Desbois, Michel Bulletin de la Societe Chimique de France, 1986 , # 6 p. 885 - 890 |
|
~%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 4 p. 1432 - 1435 |
|
~%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: WO2011/137024 A1, ; |
|
~20%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: Synthetic Communications, , vol. 32, # 5 p. 799 - 801 |
|
~%
4′-(Trifluorome... CAS#:85013-98-5 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 26 p. 5431 - 5434 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-(Trifluoromethoxy)acetophenone |
| Ethanone, 1-[4-(trifluoromethoxy)phenyl]- |
| 1-Acetyl-4-(trifluoromethoxy)benzene |
| 1-[4-(Trifluoromethoxy)phenyl]ethanone |
| FXFFOR DV1 |
| EINECS 285-066-0 |
| MFCD00042404 |
| 4′-(Trifluoromethoxy)acetophenone |