4-(Trifluoromethoxy)benzamide
4-(Trifluoromethoxy)benzamide structure
|
Common Name | 4-(Trifluoromethoxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 456-71-3 | Molecular Weight | 205.13400 | |
| Density | 1.381 g/cm3 | Boiling Point | 247.2ºC at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | 155-156°C | |
| MSDS | N/A | Flash Point | 103.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Trifluoromethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.381 g/cm3 |
|---|---|
| Boiling Point | 247.2ºC at 760 mmHg |
| Melting Point | 155-156°C |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.13400 |
| Flash Point | 103.3ºC |
| Exact Mass | 205.03500 |
| PSA | 52.32000 |
| LogP | 2.38440 |
| Vapour Pressure | 0.026mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | IDIXWLCRJFBQJA-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(OC(F)(F)F)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2924299090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 4 | |
CAS#:150162-39-3
CAS#:1736-74-9
CAS#:201230-82-2
CAS#:828-27-3
CAS#:659-28-9
CAS#:36823-88-8
CAS#:330-12-1
CAS#:330-11-0
CAS#:332-25-2
CAS#:36823-89-9
CAS#:461-82-5
CAS#:149169-34-6
CAS#:1737-06-0
CAS#:1214323-50-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00041384 |
| 4-(trifluoromethoxy)benzamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 4-(Trifluoromethoxy)benzamide? |
| A: Safety information for 4-(Trifluoromethoxy)benzamide: S26-S36/37/39. |
| Q: What are the downstream products of 4-(Trifluoromethoxy)benzamide? |
| A: Related downstream products(CAS) of 4-(Trifluoromethoxy)benzamide: 461-82-5;149169-34-6;1737-06-0;1214323-50-8. |
| Q: What is the InChIKey of 4-(Trifluoromethoxy)benzamide? |
| A: InChIKey of 4-(Trifluoromethoxy)benzamide is IDIXWLCRJFBQJA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(Trifluoromethoxy)benzamide? |
| A: Molecular weight of 4-(Trifluoromethoxy)benzamide is 205.13400. |
| Q: What is the boiling point of 4-(Trifluoromethoxy)benzamide? |
| A: Boiling point of 4-(Trifluoromethoxy)benzamide is 247.2ºC at 760 mmHg. |
| Q: What English synonyms does 4-(Trifluoromethoxy)benzamide have? |
| A: English synonyms of 4-(Trifluoromethoxy)benzamide: MFCD00041384, 4-(trifluoromethoxy)benzamide. |
| Q: What is the LogP of 4-(Trifluoromethoxy)benzamide? |
| A: LogP of 4-(Trifluoromethoxy)benzamide is 2.38440. |
| Q: What is the SMILES notation of 4-(Trifluoromethoxy)benzamide? |
| A: SMILES notation of 4-(Trifluoromethoxy)benzamide is NC(=O)c1ccc(OC(F)(F)F)cc1. |
| Q: What is the polar surface area (PSA) of 4-(Trifluoromethoxy)benzamide? |
| A: Polar surface area (PSA) of 4-(Trifluoromethoxy)benzamide is 52.32000. |
| Q: What is the molecular formula of 4-(Trifluoromethoxy)benzamide? |
| A: Molecular formula of 4-(Trifluoromethoxy)benzamide is C8H6F3NO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |