4-(Trifluoromethoxy)benzamide structure
|
Common Name | 4-(Trifluoromethoxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 456-71-3 | Molecular Weight | 205.13400 | |
| Density | 1.381 g/cm3 | Boiling Point | 247.2ºC at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | 155-156°C | |
| MSDS | N/A | Flash Point | 103.3ºC | |
| Name | 4-(Trifluoromethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381 g/cm3 |
|---|---|
| Boiling Point | 247.2ºC at 760 mmHg |
| Melting Point | 155-156°C |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.13400 |
| Flash Point | 103.3ºC |
| Exact Mass | 205.03500 |
| PSA | 52.32000 |
| LogP | 2.38440 |
| Vapour Pressure | 0.026mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | IDIXWLCRJFBQJA-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(OC(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00041384 |
| 4-(trifluoromethoxy)benzamide |