AC-GLY-ONP structure
|
Common Name | AC-GLY-ONP | ||
|---|---|---|---|---|
| CAS Number | 3304-61-8 | Molecular Weight | 238.197 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 493.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5±24.6 °C | |
| Name | (4-nitrophenyl) 2-acetamidoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.9±30.0 °C at 760 mmHg |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.197 |
| Flash Point | 252.5±24.6 °C |
| Exact Mass | 238.058975 |
| PSA | 101.22000 |
| LogP | 0.36 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | HYJPMVGCQNBYPC-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~66%
AC-GLY-ONP CAS#:3304-61-8 |
| Literature: Igglessi-Markopoulou, Olga; Sandris, Constantine Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1599 - 1606 |
|
~%
AC-GLY-ONP CAS#:3304-61-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 22, p. 1599 - 1606 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Glycine, N-acetyl-, 4-nitrophenyl ester |
| p-nitrophenyl N-acetylglycinate |
| 4-Nitrophenyl N-acetylglycinate |
| N-acetylglycine p-nitrophenyl ester |
| AmbotzAAA1916 |
| Aceturic acid p-nitrophenyl ester |
| N-acetyl-glycine-4-nitrophenyl ester |
| AC-GLY-ONP |