Ac-Gly-Pro-AFC structure
|
Common Name | Ac-Gly-Pro-AFC | ||
|---|---|---|---|---|
| CAS Number | 886993-02-8 | Molecular Weight | 425.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18F3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ac-Gly-Pro-AFCAc-Gly-Pro-AFC is a fluorogenic substrate for the determination of fibroblast activation protein (FAP) endopeptidase activity[1]. |
| Name | Ac-Gly-Pro-AFC |
|---|
| Description | Ac-Gly-Pro-AFC is a fluorogenic substrate for the determination of fibroblast activation protein (FAP) endopeptidase activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H18F3N3O5 |
|---|---|
| Molecular Weight | 425.36 |
| Exact Mass | 425.12000 |
| PSA | 108.72000 |
| LogP | 2.27920 |
| InChIKey | SKKLIRUAUNZTRY-AWEZNQCLSA-N |
| SMILES | CC(=O)NCC(=O)N1CCCC1C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |