1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol structure
|
Common Name | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 330562-43-1 | Molecular Weight | 282.06100 | |
| Density | 1.654g/cm3 | Boiling Point | 117ºC | |
| Molecular Formula | C5H3F9O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.9ºC | |
| Name | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.654g/cm3 |
|---|---|
| Boiling Point | 117ºC |
| Molecular Formula | C5H3F9O3 |
| Molecular Weight | 282.06100 |
| Flash Point | 79.9ºC |
| Exact Mass | 281.99400 |
| PSA | 38.69000 |
| LogP | 2.31010 |
| Index of Refraction | 1.296 |
| InChIKey | MRBIEXKSTURAOV-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909499000 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethanol |