2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)- (9CI) structure
|
Common Name | 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3327-24-0 | Molecular Weight | 254.28100 | |
| Density | 1.197g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 91-92ºC | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | 2'-hydroxy-4-methoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Melting Point | 91-92ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 167.3ºC |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.29690 |
| Index of Refraction | 1.631 |
| InChIKey | NXBNYUSXDBHELA-DHZHZOJOSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccccc2O)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914509090 |
|
~88%
2-Propen-1-one,... CAS#:3327-24-0 |
| Literature: Sagrera, Gabriel; Bertucci, Ana; Vazquez, Alvaro; Seoane, Gustavo Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 10 p. 3060 - 3073 |
|
~71%
2-Propen-1-one,... CAS#:3327-24-0 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 28, p. 279 - 281 |
|
~55%
2-Propen-1-one,... CAS#:3327-24-0 |
| Literature: KAOHSIUNG MEDICAL UNIVERSITY; WU, YANG-CHANG; CHANG, FANG-RONG; HSIEH, TUSTY-JIUAN; JUO, SUH-HANG; LIN, AN-SHEN; DU, YING-CHI Patent: US2013/40996 A1, 2013 ; Location in patent: Paragraph 0037-0040 ; |
|
~12%
2-Propen-1-one,... CAS#:3327-24-0 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1299 - 1305 |
|
~%
2-Propen-1-one,... CAS#:3327-24-0 |
| Literature: Chemistry - A European Journal, , vol. 18, # 40 p. 12764 - 12772 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one (en) |
| 2'-Hydroxy-2-(4-methoxybenzylidene)acetophenone |
| 4-Methoxy-2'-hydroxychalcone |
| 1-(2-HYDROXYPHENYL)-3-(4-METHOXYPHENYL)PROP-2-EN-1-ONE |
| 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one |
| 3-(4'-methoxyphenyl)-1-(2'-hydroxyphenyl)-2-propene-1-one |
| 2'-Hydroxy-2-(4-methoxybenzal)acetophenone |
| 3-(4"-methoxyphenyl)-1-(2'-hydroxyphenyl)-2-propen-1-one |
| 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)propenone |
| 1-(o-hydroxyphenyl)-3-(p-methoxyphenyl)-2-propen-1-one |