1,4-Naphthalenedione,2-(3,7-dimethyloctyl)-3-hydroxy- structure
|
Common Name | 1,4-Naphthalenedione,2-(3,7-dimethyloctyl)-3-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 3343-37-1 | Molecular Weight | 314.41900 | |
| Density | 1.099g/cm3 | Boiling Point | 447.8ºC at 760mmHg | |
| Molecular Formula | C20H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.7ºC | |
| Name | 3-(3,7-dimethyloctyl)-4-hydroxynaphthalene-1,2-dione |
|---|
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760mmHg |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.41900 |
| Flash Point | 238.7ºC |
| Exact Mass | 314.18800 |
| PSA | 54.37000 |
| LogP | 5.12030 |
| Index of Refraction | 1.547 |
| InChIKey | GFCHWTMLPIXTQO-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
1,4-Naphthalene... CAS#:3343-37-1 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
|
~%
1,4-Naphthalene... CAS#:3343-37-1 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
|
~%
1,4-Naphthalene... CAS#:3343-37-1 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |