2-Chloro-8-ethyl-quinoline-3-carbaldehyde structure
|
Common Name | 2-Chloro-8-ethyl-quinoline-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 335196-05-9 | Molecular Weight | 219.66700 | |
| Density | 1.268g/cm3 | Boiling Point | 360.3ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 171.7ºC | |
| Name | 2-chloro-8-ethylquinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 360.3ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.66700 |
| Flash Point | 171.7ºC |
| Exact Mass | 219.04500 |
| PSA | 29.96000 |
| LogP | 3.26310 |
| Index of Refraction | 1.652 |
| InChIKey | OCNAMDQJNZGZIH-UHFFFAOYSA-N |
| SMILES | CCc1cccc2cc(C=O)c(Cl)nc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~86%
2-Chloro-8-ethy... CAS#:335196-05-9 |
| Literature: Ali; Tasneem; Rajanna; Sai Prakash Synlett, 2001 , # 2 p. 251 - 253 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-8-ethyl-3-formylquinoline |
| 2-chloro-8-ethyl-quinoline-3-carbaldehyde |
| 2-Chloro-8-ethylquinoline-3-carboxaldehyde |