AKOS BB-7578 structure
|
Common Name | AKOS BB-7578 | ||
|---|---|---|---|---|
| CAS Number | 880105-72-6 | Molecular Weight | 216.66600 | |
| Density | 1.269g/cm3 | Boiling Point | 380.971ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 184.205ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Chloro-8-ethylquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 380.971ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.66600 |
| Flash Point | 184.205ºC |
| Exact Mass | 216.04500 |
| PSA | 36.68000 |
| LogP | 3.32228 |
| Index of Refraction | 1.63 |
| InChIKey | XLZCPZRZKGVZIP-UHFFFAOYSA-N |
| SMILES | CCc1cccc2cc(C#N)c(Cl)nc12 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
~84%
AKOS BB-7578 CAS#:880105-72-6 |
| Literature: Srivastava, Ambika; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 9 p. 1868 - 1875 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Quinolinecarbonitrile,2-chloro-8-ethyl |
| 2-CHLORO-8-ETHYL-3-QUINOLINECARBONITRILE |
| 2-chloro-3-cyano-8-ethylquinoline |
| 8-ethyl-2-chloro-3-cyanoquinoline |