Z-Leu-OSu structure
|
Common Name | Z-Leu-OSu | ||
|---|---|---|---|---|
| CAS Number | 3397-35-1 | Molecular Weight | 362.377 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O6 | Melting Point | 118-120ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Leu-OSuZ-Leu-Osu is a leucine derivative[1]. |
| Name | z-leu-osu |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Leu-Osu is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 118-120ºC |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.377 |
| Exact Mass | 362.147797 |
| PSA | 102.01000 |
| LogP | 1.60 |
| Index of Refraction | 1.561 |
| InChIKey | YHZUOMRURVTBMO-AWEZNQCLSA-N |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| Storage condition | −20°C |
| Safety Phrases | S22 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (S)-2,5-Dioxopyrrolidin-1-yl 2-(((benzyloxy)carbonyl)amino)-4-methylpentanoate |
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]-L-leucinate |
| Cbz-L-leucine-N-hydroxysuccinimide ester |
| EINECS 222-256-4 |
| L-Leucine, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| 2,5-dioxopyrrolidin-1-yl 2-benzyloxycarbonylamino-4-methylvalerate |
| CBZ-L-LEUCINE N-SUCCINIMIDE ESTER |
| N-Carbobenzoxy-L-leucine N-SucciniMidyl Ester |
| MFCD00042759 |
| 2,5-Dioxopyrrolidin-1-yl N-[(benzyloxy)carbonyl]-L-leucinate |
| Cbz-L-Leucine N-succinimidyl ester |
| N-Cbz-L-leucine N-Succinimidyl Ester |
| Benzyl (S)-(1-(((2,5-dioxo-1-pyrrolidinyl)oxy)carbonyl)-3-methylbutyl)carbamate |