1-(6-Fluoro-1H-indol-3-yl)-N,N-dimethylmethanamine structure
|
Common Name | 1-(6-Fluoro-1H-indol-3-yl)-N,N-dimethylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 343-93-1 | Molecular Weight | 192.233 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 297.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H13FN2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 133.8±23.2 °C | |
| Name | 1-(6-fluoro-1H-indol-3-yl)-N,N-dimethylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.7±25.0 °C at 760 mmHg |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.233 |
| Flash Point | 133.8±23.2 °C |
| Exact Mass | 192.106277 |
| PSA | 19.03000 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | PAAOUYLDLVHKKR-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1c[nH]c2cc(F)ccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~85%
1-(6-Fluoro-1H-... CAS#:343-93-1 |
| Literature: US2011/152539 A1, ; Page/Page column 4 ; |
|
~97%
1-(6-Fluoro-1H-... CAS#:343-93-1 |
| Literature: US2011/152539 A1, ; Page/Page column 4 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (6-fluoro-1H-indol-3-ylmethyl)dimethylamine |
| (6-fluoro-indol-3-ylmethyl)-dimethyl-amine |
| 1H-Indole-3-methanamine, 6-fluoro-N,N-dimethyl- |
| 1-(6-Fluoro-1H-indol-3-yl)-N,N-dimethylmethanamine |
| MFCD00056918 |
| 6-Fluoro-3-(dimethylaminomethyl)indole |
| (6-Fluor-indol-3-ylmethyl)-dimethyl-amin |
| 6-Fluorogramine |
| 6-Fluor-gramin |