NS 3623 structure
|
Common Name | NS 3623 | ||
|---|---|---|---|---|
| CAS Number | 343630-41-1 | Molecular Weight | 427.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10BrF3N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NS 3623NS3623 is a hERG (KV11.1) and KV4.3 channel activator. NS3623 activates the IKr and Ito currents and has antiarrhythmic effect[1][2]. |
| Name | 1-[4-Bromo-2-(1H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phen yl]ure |
|---|
| Description | NS3623 is a hERG (KV11.1) and KV4.3 channel activator. NS3623 activates the IKr and Ito currents and has antiarrhythmic effect[1][2]. |
|---|---|
| References |
| Molecular Formula | C15H10BrF3N6O |
|---|---|
| Molecular Weight | 427.17900 |
| Exact Mass | 426.00500 |
| PSA | 99.08000 |
| LogP | 4.37860 |
| InChIKey | JXPULDIATMTIIN-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(Br)cc1-c1nn[nH]n1 |