BOC-LYS(Z)-OSU structure
|
Common Name | BOC-LYS(Z)-OSU | ||
|---|---|---|---|---|
| CAS Number | 34404-36-9 | Molecular Weight | 477.508 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H31N3O8 | Melting Point | 108-115ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of BOC-LYS(Z)-OSUBoc-Lys(Z)-OSu is a lysine derivative[1]. |
| Name | Boc-Lys(Z)-OSu |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Lys(Z)-OSu is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 108-115ºC |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.508 |
| Exact Mass | 477.211121 |
| PSA | 140.34000 |
| LogP | 1.62 |
| Index of Refraction | 1.557 |
| InChIKey | YWLICOCXPNQJPC-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~83%
BOC-LYS(Z)-OSU CAS#:34404-36-9 |
| Literature: Jaoudai, Mahmoud; Martinez, Jean; Castro, Bertrand Journal of Organic Chemistry, 1987 , vol. 52, # 12 p. 2364 - 2367 |
|
~99%
BOC-LYS(Z)-OSU CAS#:34404-36-9 |
| Literature: Rosowsky, Andre; Wright, Joel E. Journal of Organic Chemistry, 1989 , vol. 54, # 23 p. 5551 - 5558 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| EINECS 251-999-7 |
| 2,5-Dioxopyrrolidin-1-yl N-[(benzyloxy)carbonyl]-N-(tert-butoxycarbonyl)-L-lysinate |
| Boc-Lys-(CBz)-succinimide ester |
| N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-L-lysine 2,5-dioxo-1-pyrrolidinyl ester |
| NEPSILON-Benzyloxycarbonyl-NALPHA-tert-butoxycarbonyl-L-lysine-hydroxysuccinimid |
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}lysinate |
| Boc-Lys(Ne-Cbz)-ONSu |
| Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| MFCD00037915 |
| NA-BOC-NE-CBZ-L-LYSINEHYDROXYSUCCINIMIDEESTER |
| Benzyl (S)-(5-(((1,1-dimethylethoxy)carbonyl)amino)-6-((2,5-dioxo-1-pyrrolidinyl)oxy)-6-oxohexyl)carbamate |
| N-(tert-butoxycarbonyl)-N-Z-L-lysine hydroxysuccinimide |
| N-[(N2,N6-Dicarboxy-L-lysyl)oxy]succinimide N6-benzyl tert-butyl ester |
| 2,5-dioxopyrrolidin-1-yl (S)-6-[(benzyloxycarbonyl)amino]-2-[(tert-butoxycarbonyl)amino]hexanoate |
| L-Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| Boc-Lys(Z)-Osu |
| Boc-Lyz(Z)-OSu |