1,3-Propanediol,1,3-dinitrate structure
|
Common Name | 1,3-Propanediol,1,3-dinitrate | ||
|---|---|---|---|---|
| CAS Number | 3457-90-7 | Molecular Weight | 166.09000 | |
| Density | 1.427g/cm3 | Boiling Point | 234ºC at 760mmHg | |
| Molecular Formula | C3H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.8ºC | |
| Name | 3-nitrooxypropyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 234ºC at 760mmHg |
| Molecular Formula | C3H6N2O6 |
| Molecular Weight | 166.09000 |
| Flash Point | 118.8ºC |
| Exact Mass | 166.02300 |
| PSA | 110.10000 |
| LogP | 0.83950 |
| Index of Refraction | 1.453 |
| InChIKey | KOSAMXZBGUIISK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCCO[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~89%
1,3-Propanediol... CAS#:3457-90-7 |
| Literature: DSM IP ASSETS B.V.; Duval, Stephane; Kindermann, Maik Patent: US2014/147529 A1, 2014 ; Location in patent: Paragraph 0132; 0133 ; |
|
~88%
1,3-Propanediol... CAS#:3457-90-7 |
| Literature: Secretary of State for Defence, in Her Britannic Majesty's Gov., of the United Kingdom of, Great Britain and Northern Ireland Patent: EP223440 B1, 1991 ; |
|
~91%
1,3-Propanediol... CAS#:3457-90-7 |
| Literature: Kuchurov, Ilya V.; Fomenkov, Igor V.; Zlotin, Sergei G.; Tartakovsky, Vladimir A. Mendeleev Communications, 2012 , vol. 22, # 2 p. 67 - 69 |
|
~%
1,3-Propanediol... CAS#:3457-90-7 |
| Literature: Fichter; Bloch Helvetica Chimica Acta, 1939 , vol. 22, p. 1534 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Trimethylene dinitrate |
| 1,3-propyl dinitrate |
| 1,3-Bis-nitryloxy-propan |
| propane-1,3-diol dinitrate |
| 1,3-Propylene glycol dinitrate |
| 1,3-bis-nitryloxy-propane |
| Trimethylene nitrate |
| propane-1,3-diyl dinitrate |
| 1,3-Propanediol dinitrate |
| 1,3-bis-nitrooxy-propane |