3,6-Dichloro-1-benzothiophene-2-carbonyl chloride structure
|
Common Name | 3,6-Dichloro-1-benzothiophene-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 34576-85-7 | Molecular Weight | 265.543 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 375.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H3Cl3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6±26.5 °C | |
| Name | 3,6-dichloro-1-benzothiophene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.0±37.0 °C at 760 mmHg |
| Molecular Formula | C9H3Cl3OS |
| Molecular Weight | 265.543 |
| Flash Point | 180.6±26.5 °C |
| Exact Mass | 263.897003 |
| PSA | 45.31000 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | JCTLRFNZVZCAHR-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1sc2cc(Cl)ccc2c1Cl |
| Hazard Codes | C |
|---|---|
| Safety Phrases | 20-26-36/37/39-45 |
| RIDADR | UN3261 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2934999090 |
|
~%
3,6-Dichloro-1-... CAS#:34576-85-7 |
| Literature: Letters in Drug Design and Discovery, , vol. 11, # 3 p. 349 - 354 |
|
~71%
3,6-Dichloro-1-... CAS#:34576-85-7 |
| Literature: Ried, Walter; Oremek, Gerhard; Ocakcioglu, Belkis Liebigs Annalen der Chemie, 1980 , # 9 p. 1424 - 1427 |
|
~53%
3,6-Dichloro-1-... CAS#:34576-85-7 |
| Literature: Obushak; Matiichuk; Martyak Chemistry of Heterocyclic Compounds, 2003 , vol. 39, # 7 p. 878 - 884 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlorcarbonyl-3,6-dichlorbenzo<b>thiophen |
| 3,6-Dichloro-1-benzothiophene-2-carbonyl chloride |
| Benzo[b]thiophene-2-carbonyl chloride, 3,6-dichloro- |
| 3,6-Dichlor-benzo-<b>-thiophen-2-carbonsaeurechlorid |