SB 611812 structure
|
Common Name | SB 611812 | ||
|---|---|---|---|---|
| CAS Number | 345892-71-9 | Molecular Weight | 491.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16Cl3F3N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SB 611812SB-611812 is a urotensin II receptor (UTR) antagonist with the potential in the treatment of cardiovascular disease[1][2]. |
| Name | 2,6-Dichloro-N-{4-chloro-3-[2-(dimethylamino)ethoxy]phenyl}-4-(tr ifluoromethyl)benzenesulfonamide |
|---|
| Description | SB-611812 is a urotensin II receptor (UTR) antagonist with the potential in the treatment of cardiovascular disease[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H16Cl3F3N2O3S |
|---|---|
| Molecular Weight | 491.74000 |
| Exact Mass | 489.99000 |
| PSA | 67.02000 |
| LogP | 6.56060 |
| InChIKey | UIZHOFJFIOCYLH-UHFFFAOYSA-N |
| SMILES | CN(C)CCOc1cc(NS(=O)(=O)c2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1Cl |
| Storage condition | -20°C |
|
~%
SB 611812 CAS#:345892-71-9 |
| Literature: Dhanak, Dashyant; Knight, Steven David Patent: US2003/100580 A1, 2003 ; US 20030100580 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |