Wy 7953 structure
|
Common Name | Wy 7953 | ||
|---|---|---|---|---|
| CAS Number | 3485-08-3 | Molecular Weight | 327.39900 | |
| Density | 1.44g/cm3 | Boiling Point | 646.5ºC at 760 mmHg | |
| Molecular Formula | C14H21N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.8ºC | |
| Name | 6-[(1-aminocyclopentanecarbonyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 646.5ºC at 760 mmHg |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.39900 |
| Flash Point | 344.8ºC |
| Exact Mass | 327.12500 |
| PSA | 138.03000 |
| LogP | 0.91870 |
| Index of Refraction | 1.642 |
| InChIKey | JBSBDUODFNGBJT-KHQFGBGNSA-N |
| SMILES | CC1(C)SC2C(NC(=O)C3(N)CCCC3)C(=O)N2C1C(=O)O |
|
~%
Wy 7953 CAS#:3485-08-3 |
| Literature: Grant,N.H.; Alburn,H.E. Journal of the American Chemical Society, 1964 , vol. 86, p. 3870 - 3873 |
|
~%
Wy 7953 CAS#:3485-08-3 |
| Literature: Grant,N.H.; Alburn,H.E. Journal of the American Chemical Society, 1964 , vol. 86, p. 3870 - 3873 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |