ethyl 3-(4-nitrophenyl)prop-2-ynoate structure
|
Common Name | ethyl 3-(4-nitrophenyl)prop-2-ynoate | ||
|---|---|---|---|---|
| CAS Number | 35283-08-0 | Molecular Weight | 219.19300 | |
| Density | 1.28g/cm3 | Boiling Point | 350.2ºC at 760mmHg | |
| Molecular Formula | C11H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4ºC | |
| Name | ethyl 3-(4-nitrophenyl)prop-2-ynoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 350.2ºC at 760mmHg |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.19300 |
| Flash Point | 159.4ºC |
| Exact Mass | 219.05300 |
| PSA | 72.12000 |
| LogP | 2.03260 |
| Index of Refraction | 1.567 |
| InChIKey | VOFGHYIUFUAZQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C#Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethyl 4-nitrophenylpropiolate |