3,5-diacetoxybenzoic acid structure
|
Common Name | 3,5-diacetoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35354-29-1 | Molecular Weight | 238.19300 | |
| Density | 1.344g/cm3 | Boiling Point | 408.4ºC at 760mmHg | |
| Molecular Formula | C11H10O6 | Melting Point | 158-160°C | |
| MSDS | N/A | Flash Point | 160.4ºC | |
| Name | 3,5-diacetyloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760mmHg |
| Melting Point | 158-160°C |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19300 |
| Flash Point | 160.4ºC |
| Exact Mass | 238.04800 |
| PSA | 89.90000 |
| LogP | 1.23540 |
| Index of Refraction | 1.543 |
| InChIKey | QBTDQJMLMVEUTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)O)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
|
~92%
3,5-diacetoxybe... CAS#:35354-29-1 |
| Literature: AMOREPACIFIC CORPORATION Patent: WO2007/21067 A1, 2007 ; Location in patent: Page/Page column 4-5; 8 ; |
|
~77%
3,5-diacetoxybe... CAS#:35354-29-1 |
| Literature: Brigham Young University Patent: US2008/255382 A1, 2008 ; Location in patent: Page/Page column 25 ; |
|
~49%
3,5-diacetoxybe... CAS#:35354-29-1 |
| Literature: Hoechst Celanese Corp. Patent: US5777129 A1, 1998 ; |
|
~%
3,5-diacetoxybe... CAS#:35354-29-1 |
| Literature: Journal of the American Chemical Society, , vol. 114, # 9 p. 3346 - 3355 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| 3,5-Diacetoxy-benzoesaeure |
| 3,5-diacetoxy-benzoic acid |
| MFCD00017591 |
| 3,5-Bis(acetyloxy)benzoic acid |
| 3.5-Diacetoxibenzoesaeure |
| 3,5-DIACETOXYBENZOIC ACID |