(5-PHENYL-2-UREIDO)THIOPHENE-3-CARBOXAMIDE structure
|
Common Name | (5-PHENYL-2-UREIDO)THIOPHENE-3-CARBOXAMIDE | ||
|---|---|---|---|---|
| CAS Number | 354811-10-2 | Molecular Weight | 261.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (5-PHENYL-2-UREIDO)THIOPHENE-3-CARBOXAMIDEIKK2-IN-4 (compound 4) is a potent IKK-2 inhibitor, with an IC50 of 25 nM. IKK2-IN-4 can inhibit the LPS-induced production of TNFα in PBMCs[1]. |
| Name | 2-(carbamoylamino)-5-phenylthiophene-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | IKK2-IN-4 (compound 4) is a potent IKK-2 inhibitor, with an IC50 of 25 nM. IKK2-IN-4 can inhibit the LPS-induced production of TNFα in PBMCs[1]. |
|---|---|
| Related Catalog | |
| Target |
IKK-2:25 nM (IC50) |
| References |
| Molecular Formula | C12H11N3O2S |
|---|---|
| Molecular Weight | 261.30 |
| Exact Mass | 261.05700 |
| PSA | 128.43000 |
| LogP | 3.47560 |
| InChIKey | PSVUSJKZJQMCSP-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1sc(-c2ccccc2)cc1C(N)=O |
| IN1462 |
| HMS3229F13 |
| HMS2043P17 |
| IKK-2 Inhibitor VI |