methyl heptafluoropropyl ketone structure
|
Common Name | methyl heptafluoropropyl ketone | ||
|---|---|---|---|---|
| CAS Number | 355-17-9 | Molecular Weight | 212.06600 | |
| Density | 1.447g/cm3 | Boiling Point | 63 °C | |
| Molecular Formula | C5H3F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63-64°C | |
| Name | 3,3,4,4,5,5,5-heptafluoropentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 63 °C |
| Molecular Formula | C5H3F7O |
| Molecular Weight | 212.06600 |
| Flash Point | 63-64°C |
| Exact Mass | 212.00700 |
| PSA | 17.07000 |
| LogP | 2.40830 |
| InChIKey | XJYXROGTQYHLTH-UHFFFAOYSA-N |
| SMILES | CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R11;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 1224 |
| Packaging Group | II |
| Hazard Class | 3 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00042079 |
| 3,3,4,4,5,5,5-heptafluoro-pentan-2-one |
| 5,5,5,4,4,3,3-heptafluoro-2-pentanone |
| 1,1,1,2,2,3,3-heptafluoropentan-4-one |
| 3,3,4,4,5,5,5-Heptafluoro-2-pentanone |
| 1H,1H,1H-heptafluoro-pentan-2-one |
| EINECS 206-577-7 |
| methyl heptafluoropropylketone |