N-Bromosaccharin structure
|
Common Name | N-Bromosaccharin | ||
|---|---|---|---|---|
| CAS Number | 35812-01-2 | Molecular Weight | 262.08100 | |
| Density | 2.063g/cm3 | Boiling Point | 404.4ºC at 760mmHg | |
| Molecular Formula | C7H4BrNO3S | Melting Point | 160ºC | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | 2-bromo-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.063g/cm3 |
|---|---|
| Boiling Point | 404.4ºC at 760mmHg |
| Melting Point | 160ºC |
| Molecular Formula | C7H4BrNO3S |
| Molecular Weight | 262.08100 |
| Flash Point | 198.3ºC |
| Exact Mass | 260.91000 |
| PSA | 62.83000 |
| LogP | 2.15970 |
| Index of Refraction | 1.714 |
| InChIKey | QRADPXNAURXMSB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1Br |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2934100090 |
|
~84%
N-Bromosaccharin CAS#:35812-01-2 |
| Literature: Synlett, , # 2 p. 194 - 200 |
|
~64%
N-Bromosaccharin CAS#:35812-01-2 |
| Literature: Synthetic Communications, , vol. 33, # 6 p. 935 - 939 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-BROMO-1,2-BENZISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE |
| N-Bromosaccharin |