rosamicin structure
|
Common Name | rosamicin | ||
|---|---|---|---|---|
| CAS Number | 35834-26-5 | Molecular Weight | 581.73800 | |
| Density | 1.17g/cm3 | Boiling Point | 734.7ºC at 760mmHg | |
| Molecular Formula | C31H51NO9 | Melting Point | 119-122° | |
| MSDS | USA | Flash Point | 398.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | rosaramicin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 734.7ºC at 760mmHg |
| Melting Point | 119-122° |
| Molecular Formula | C31H51NO9 |
| Molecular Weight | 581.73800 |
| Flash Point | 398.1ºC |
| Exact Mass | 581.35600 |
| PSA | 135.13000 |
| LogP | 2.67040 |
| Index of Refraction | 1.532 |
| InChIKey | IUPCWCLVECYZRV-DIPWYQAOSA-N |
| SMILES | CCC1OC(=O)CC(O)C(C)C(OC2OC(C)CC(N(C)C)C2O)C(CC=O)CC(C)C(=O)C=CC2(C)OC2C1C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | JG6800000 |
|
A new Micromonospora-produced macrolide antibiotic, rosamicin.
J. Antibiot. 25 , 641, (1972)
|
|
|
Function of cytochrome P450 enzymes RosC and RosD in the biosynthesis of rosamicin macrolide antibiotic produced by Micromonospora rosaria.
Antimicrob. Agents Chemother. 57(3) , 1529-31, (2013) The cytochrome P450 enzyme-encoding genes rosC and rosD were cloned from the rosamicin biosynthetic gene cluster of Micromonospora rosaria IFO13697. The functions of RosC and RosD were demonstrated by... |
|
|
Role of glycosylation and deglycosylation in biosynthesis of and resistance to oleandomycin in the producer organism, Streptomyces antibioticus.
J. Bacteriol. 174(1) , 161-5, (1992) Cell extracts of Streptomyces antibioticus, an oleandomycin producer, can inactivate oleandomycin in the presence of UDP-glucose. The inactivation can be detected through the loss of biological activi... |
| Rosaramicina [INN-Spanish] |
| Cirramycin A1,4'-deoxy |
| 2-[(14E)-9-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-ethyl-7-hydroxy-2,8,12,16-tetramethyl-5,13-dioxo-4,17-dioxabicyclo[14.1.0]heptadec-14-en-10-yl]acetaldehyde |
| Antibiotic 67-694 |
| Juvenimicin A3 Rosaramicin |
| ROSAMICIN |
| Juvenimicin A3 |
| Rosaramicine [INN-French] |
| Antibiotic M 4365A2 |
| Rosaramicin |
| Rosaramicinum [INN-Latin] |