Tetraethylazanium,trifluoromethanesulfonate structure
|
Common Name | Tetraethylazanium,trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 35895-69-3 | Molecular Weight | 279.320 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20F3NO3S | Melting Point | 161-163 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tetraethylazanium,trifluoromethanesulfonateTetraethylammonium Trifluoromethanesulfonate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | tetraethylazanium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraethylammonium Trifluoromethanesulfonate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 161-163 °C |
|---|---|
| Molecular Formula | C9H20F3NO3S |
| Molecular Weight | 279.320 |
| Exact Mass | 279.111603 |
| PSA | 65.58000 |
| LogP | 3.01500 |
| InChIKey | PUZYNDBTWXJXKN-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)F |
| Water Solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~84%
Tetraethylazani... CAS#:35895-69-3 |
| Literature: Bianchini, Giulio; Scarso, Alessandro; Sorella, Giorgio La; Strukul, Giorgio Chemical Communications, 2012 , vol. 48, # 99 p. 12082 - 12084 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00042586 |
| TetraethylaMMoniuM TrifluoroMethanesulfonate |
| EINECS 252-781-4 |
| Tetraethylammonium Triflate |
| Tetraethylammonium trifluormethansulfonat |
| N,N,N-Triethylethanaminium trifluoromethanesulfonate |
| tetraethylammonium trifluoromethanesulphonate |
| Trifluoromethanesulfonic acid tetraethylammonium salt |
| tetramethylammonium trifluoromethylsulfonate |