dehydroabietylamine structure
|
Common Name | dehydroabietylamine | ||
|---|---|---|---|---|
| CAS Number | 35928-32-6 | Molecular Weight | 285.46700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H31N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | dehydroabietylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H31N |
|---|---|
| Molecular Weight | 285.46700 |
| Flash Point | >230 °F |
| Exact Mass | 285.24600 |
| PSA | 26.02000 |
| LogP | 5.47930 |
| Index of Refraction | n20/D 1.546(lit.) |
| InChIKey | WREBNDYJJMUWAO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=CCC3C(C)(CN)CCCC3(C)C2CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| RTECS | TP8701000 |
|
~%
dehydroabietylamine CAS#:35928-32-6 |
| Literature: Rao, Xiaoping; Song, Zhanqian; He, Ling; Jia, Weihong Chemical and Pharmaceutical Bulletin, 2008 , vol. 56, # 11 p. 1575 - 1578 |
| EINECS 215-899-7 |
| Abietyl alcohol |
| dehydroabietamide |
| Abietol |
| abieta-8,11,13-trien-18-amide |
| Abietinol |
| MFCD00213430 |
| Abieta-8,11,13-trien-18-amid |
| abietadienol |
| abieta-7,13-dien-18-ol |
| abietadien-18-ol |